Gemfibrozil CAS#: 25812-30-0; ChemWhat Kode: 137366
Identifikasi
| Nama Produk | Gemfibrozil |
| Nama IUPAC | 5-(2,5-dimethylphenoxy)-2,2-dimethylpentanoic acid |
| Struktur Molekuler |  |
| Nomor CAS | 25812-30-0 |
| Nomor EINECS | 247-280-2 |
| Nomor MDL | MFCD00079335 |
| Sinonim | gemfibrozil 25812-30-0 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic acid bodoh Jezila Decrelip Lipur CI-719 Cholespid Fibratol Fibrocit Gemfibril Gemfibromax Gemlipid Hipolixan Gemfibrozil Gemfibrozilum Renabrazin Clearol Elmogan Fetinor Gemnpid Innogen Ipolipid Lanaterom Lifibron Lipigem Lipizyl Micolip Normolip Progemzal Reducel Regulip Sinelip Synbrozil Taborcil Tentroc Brozil Gozid Hidil Lipira Gemd Gevilon Uno WL-Gemfibrozil Gen-Fibro Pentanoic acid, 5-(2,5-dimethylphenoxy)-2,2-dimethyl- Low-Lip Gem-S Lipozid 2,2-Dimethyl-5-(2,5-xylyloxy)valeric acid 2,2-Dimethyl-5-(2,5-xylyloxy)valeriansaeure Gemfibrozilum [INN-Latin] Gemfibrozilo [INN-Spanish] CCRIS 318 2,2-Dimethyl-5-(2,5-dimethylphenoxy)valeriansaeure EINECS 247-280-2 NSC-757024 BRN 1881200 Gemfibrozil (Lopid) Valeric acid, 2,2-dimethyl-5-(2,5-xylyloxy)- Bolutol CHEBI: 5296 Apo-Gemfibrozil DTXSID0020652 UNII-Q8X02027X3 HSDB 7735 Gemfibrozil (Standard) Gemfibrosil Lipazil Litarek MFCD00079335 Trialmin Ausgem Pilder CHEMBL457 Q8X02027X3 DTXCID20652 MLS000028421 Gemfibrozil [USAN:USP:INN:BAN] 2,2-Dimethyl-5-(2,5-dimethylphenoxy)pentanoic acid 5-(2,5-dimethylphenoxy)-2,2-dimethyl-pentanoic acid NSC 757024 5-[(2,5-dimethylphenyl)oxy]-2,2-dimethylpentanoic acid NCGC00016794-09 SMR000058393 Genlip CAS-25812-30-0 GEMFIBROZIL (IARC) GEMFIBROZIL [IARC] Gemfibrozilum (INN-Latin) Gemfibrozilo (INN-Spanish) GEMFIBROZIL (MART.) GEMFIBROZIL [MART.] GEMFIBROZIL (USP-RS) GEMFIBROZIL [USP-RS] 2,2-DIMETHYL-5-(2,5-XYLYLOXY) VALERIC ACID GEMFIBROZIL (EP MONOGRAPH) GEMFIBROZIL [EP MONOGRAPH] Innogem Gemcor GEMFIBROZIL (USP MONOGRAPH) GEMFIBROZIL [USP MONOGRAPH] Gemfibrozil (USAN:USP:INN:BAN) CI 719 Lopid (TN) TEVA-A SR-01000000056 Gemfibrozil (JAN/USP/INN) Gemfibrozil,(S) 4TX Prestwick_637 dimethylpentanoic acid Spektrum_000825 BPD000058393 GEMFIBROZIL [MI] 114413-98-8 Opera_ID_1658 Prestwick0_000214 Prestwick1_000214 Prestwick2_000214 Prestwick3_000214 Spektrum2_001097 Spektrum3_000440 Spektrum4_000562 Spektrum5_000750 Spektrum5_001991 GEMFIBROZIL [INN] GEMFIBROZIL [JAN] GEMFIBROZIL [HSDB] GEMFIBROZIL [INCI] GEMFIBROZIL [USAN] GEMFIBROZIL [VANDF] SCHEMBL4813 BSP Bio_000227 BSP Bio_002060 GEMFIBROZIL [WHO-DD] KBioGR_000964 KBioSS_001305 MLS001055364 MLS006011850 DivK1c_000138 SPEKTRUM 1500313 SPBio_001174 SPBio_002148 BPBio1_000251 GTPL3439 YSSJ5501 Gemfibrozil, analytical standard Kelas-719 HMS500G20 HY-B0258R KBio1_000138 KBio2_001305 KBio2_003873 KBio2_006441 KBio3_001280 C10AB04 GEMFIBROZIL [ORANGE BOOK] Gemfibrozil for system suitability NINDS_000138 HMS1568L09 HMS1920B07 HMS2090K14 HMS2091H11 HMS2095L09 HMS2230H24 HMS3259M12 HMS3655C06 HMS3712L09 Farmakon1600-10500313 5-(2,5-dimethylphenoxy)-2,2- BCP08437 HY-B0258 Tox21_110613 Tox21_201997 Tox21_302784 BBL010807 BDBM50110590 CCG-40111 DL-414 NSC757024 s1729 STK618740 AKOS001606691 racun21_110613_1 AB03034 AC-4225 DB01241 KS-5192 MCULE-4563546953 NC00565 IDI1_000138 NCGC00016794-01 NCGC00016794-02 NCGC00016794-03 NCGC00016794-04 NCGC00016794-05 NCGC00016794-06 NCGC00016794-07 NCGC00016794-08 NCGC00016794-10 NCGC00016794-11 NCGC00016794-13 NCGC00016794-14 NCGC00022722-03 NCGC00022722-04 NCGC00022722-05 NCGC00022722-06 NCGC00022722-07 NCGC00256601-01 NCGC00259546-01 SY052512 Gemfibrozil 100 microg/mL in Acetonitrile SBI-0051391.P003 2,2-Dimethyl-5-(2,5-zlyloxy)valeric acid AB00052003 CS-0694895 G0368 NS00010281 SW196802-3 2,2-Dimethyl-5-(2,5-xylyloxy)valeriansaure EN300-97098 C07020 D00334 D83091 AB00052003-15 AB00052003-16 AB00052003_17 AB00052003_18 A818037 Q384295 2,2-Dimethyl-5-(2,5-dimethylphenoxy)valeriansaure 2,2-Dimethyl-5-(2,5-dimethylphenoxy)valeric Acid 5-(2,5-dimethyphenoxy)-2,2-dimethylpentanoic acid SR-01000000056-3 SR-01000000056-4 SR-01000000056-6 SR-01000000056-7 W-107216 2,2-Dimethyl-5-(2,5-dimethylphenoxy)-pentanoic acid BRD-K11129031-001-05-1 Z1259021151 Gemfibrozil, British Pharmacopoeia (BP) Reference Standard Gemfibrozil, European Pharmacopoeia (EP) Reference Standard Gemfibrozil, United States Pharmacopeia (USP) Reference Standard Gemfibrozil, Pharmaceutical Secondary Standard; Certified Reference Material Gemfibrozil for system suitability, European Pharmacopoeia (EP) Reference Standard 2,2-Dimethyl-5-(2,5-dimethylphenoxy)pentanoic acid, 2,2-Dimethyl-5-(2,5-xylyloxy)valeric acid, 5-(2,5-Dimethylphenoxy)-2,2-dimethylpentanoic aci |
| Formula Molekuler | C15H22O3 |
| Berat molekul | 250.33 |
| inchi | InChI=1S/C15H22O3/c1-11-6-7-12(2)13(10-11)18-9-5-8-15(3,4)14(16)17/h6-7,10H,5,8-9H2,1-4H3,(H,16,17) |
| Kunci InChI | HEMJJKBWTPKOJG-UHFFFAOYSA-N |
| Isomer SMILES | CC1=CC(=C(C=C1)C)OCCCC(C)(C)C(=O)O |
| Informasi Paten | ||
| ID Paten | Judul | Tanggal penerbitan |
| WO2023 / 155912 | RECYCLABLE HIGH-REACTIVITY HYPERVALENT IODINE REAGENT | 2023 |
| CN114149341 | Aryloxycyclohexyl amide AMPK agonist as well as preparation method and medical application thereof | 2021 |
| CN112573978 | Efficient halogenation synthesis method of aryl halide | 2021 |
| WO2020 / 128816 | PHARMACEUTICAL COMPOSITIONS AND METHODS COMPRISING A COMBINATION OF A BENZOXAZOLE TRANSTHYRETIN STABILIZER AND AN ADDITIONAL THERAPEUTIC AGENT | 2020 |
| WO2020 / 243754 | LIGAND-ENABLED ß-C(sp3)–H LACTONIZATION FOR ß-C–H FUNCTIONALIZATIONS | 2020 |
Data fisik
| Penampilan | Bubuk kristal putih |
| Titik lebur, ° C |
| 334 |
| 61.2 |
| 59 - 61 |
| 58 - 70 |
| 61 - 63 |
| Titik didih, ° C |
| 158 - 159 |
| Densitas, g · cm-3 |
| 1.09 |
| Deskripsi (Asosiasi (MCS)) | Pelarut (Association (MCS)) | Mitra (Asosiasi (MCS)) |
| Konstanta stabilitas kompleks dengan… | berbagai pelarut | albumin serum manusia |
| Konstanta stabilitas kompleks dengan… | berbagai pelarut | immobilized phospholipid membrane |
| Sifat fisik lebih lanjut dari kompleks tersebut | H2O | LixAl2(OH)6*yH2O |
Spectra
| Deskripsi (Spektroskopi NMR) | Inti (Spektroskopi NMR) | Pelarut (Spektroskopi NMR) | Frekuensi (Spektroskopi NMR), MHz |
| Pergeseran kimiawi, Spectrum | 13C | kloroform-d1 | |
| Pergeseran kimiawi, Spectrum | 1H | kloroform-d1 | 500 |
| Pergeseran kimiawi, Spectrum | 13C | kloroform-d1 | 126 |
| Spektrum | 1H | ||
| Pergeseran kimiawi, Spectrum | 1H | kloroform-d1 | 400 |
| Deskripsi (Spektroskopi IR) | Pelarut (Spektroskopi IR) |
| Band, Spektrum | |
| Spektrum | |
| Band | kalium bromida |
| Band | |
| Band, Spektrum | kalium bromida |
| Deskripsi (Spektroskopi UV / VIS) | Pelarut (Spektroskopi UV / VIS) | Komentar (Spektroskopi UV / VIS) | Absorpsi Maxima (UV / VIS), nm |
| Spektrum | 198.3, 275.2 | ||
| Spektrum | water, dimethyl sulfoxide | 274 | |
| Spektrum | metanol, air | ||
Rute Sintesis (ROS)
| Kondisi | Menghasilkan |
| With dmap; dicyclohexyl-carbodiimide In dichloromethane | 98% |
| With dmap; 1-ethyl-(3-(3-dimethylamino)propyl)-carbodiimide hydrochloride In tetrahydrofuran at 20℃; Inert atmosphere; | 98% |
| With dmap; dicyclohexyl-carbodiimide In dichloromethane at 20℃; | 94% |
Keamanan dan Bahaya
| Piktogram |    |
| Sinyal | peringatan |
| Pernyataan Bahaya GHS | H302 (100%): Berbahaya jika tertelan [Peringatan Toksisitas akut, oral] H351 (24.62%): Diduga menyebabkan kanker [Peringatan Karsinogenisitas] H361 (26.15%): Diduga dapat merusak kesuburan atau janin [Peringatan Toksisitas reproduktif] H411 (24.62%): Toksik pada kehidupan air dengan efek jangka panjang [Berbahaya bagi lingkungan air, bahaya jangka panjang] |
| Kode Pernyataan Kehati-hatian | P203, P264, P270, P273, P280, P301+P317, P318, P330, P391, P405, dan P501 (Pernyataan yang sesuai untuk setiap P-code dapat ditemukan di Klasifikasi GHS Halaman.) |
data lainnya
| Transportasi | Di bawah suhu ruangan dan jauh dari cahaya |
| Kode HS | |
| Storage | Di bawah suhu ruangan dan jauh dari cahaya |
| Shelf Life | 3 tahun |
| Harga pasar |
| Keserupaan obat | |
| Komponen aturan Lipinski | |
| Berat molekul | 250.338 |
| logP | 3.35 |
| HBA | 2 |
| HBD | 1 |
| Mencocokkan Aturan Lipinski | 4 |
| Komponen aturan Veber | |
| Area Permukaan Kutub (PSA) | 46.53 |
| Bond yang Dapat Diputar (RotB) | 6 |
| Mencocokkan Aturan Veber | 2 |
| Gunakan Pola |
| Gemfibrozil, with the chemical name 2,2-dimethyl-5-(2,5-dimethylphenoxy)pentanoic acid. Gemfibrozil is a fibrate class lipid-regulating medication derived from clofibrate. It was introduced to the market in the United States in 1982. Gemfibrozil overcomes the serious hepatic toxicity associated with earlier lipid-lowering drugs such as clofibrate while retaining its efficacy. It promotes the breakdown of peripheral fat, reduces the hepatic uptake of free fatty acids, thereby decreasing intrahepatic triglyceride formation. Additionally, it inhibits the synthesis of very-low-density lipoprotein (VLDL) and reduces the generation of VLDL. |
Beli Reagen | |
| Tidak ada pemasok reagen? | Kirim pertanyaan cepat ke ChemWhat |
| Ingin terdaftar di sini sebagai pemasok reagen? (Layanan berbayar) | Klik di sini untuk menghubungi ChemWhat |
Produsen yang Disetujui | |
| Caming Pharmaceutical Limited | http://www.caming.com/ |
| Ingin terdaftar sebagai produsen yang disetujui (Memerlukan persetujuan)? | Silakan unduh dan isi formulir ini dan kirim kembali ke [email dilindungi] |
Hubungi Kami untuk Bantuan Lainnya | |
| Hubungi kami untuk informasi atau layanan lainnya | Klik di sini untuk menghubungi ChemWhat |